C27H39NO3 — CID 136805582
2-[(4-hexoxyphenyl)iminomethyl]-5-octoxyphenol (PubChem CID 136805582) has the molecular formula C27H39NO3 and a molecular weight of 425.61 g/mol. Its IUPAC name is 2-[(4-hexoxyphenyl)iminomethyl]-5-octoxyphenol.
| Compound Name | 2-[(4-hexoxyphenyl)iminomethyl]-5-octoxyphenol |
|---|---|
| PubChem CID | 136805582 |
| Molecular Formula | C27H39NO3 |
| Molecular Weight | 425.61 g/mol |
| Exact Mass | 425.29 |
| IUPAC Name | 2-[(4-hexoxyphenyl)iminomethyl]-5-octoxyphenol |
| SMILES | CCCCCCCCOc1ccc(/C=N/c2ccc(OCCCCCC)cc2)c(O)c1 |
| InChI | InChI=1S/C27H39NO3/c1-3-5-7-9-10-12-20-31-26-16-13-23(27(29)21-26)22-28-24-14-17-25(18-15-24)30-19-11-8-6-4-2/h13-18,21-22,29H,3-12,19-20H2,1-2H3/b28-22+ |
| InChIKey | ROCZDPSZDHXSJR-XAYXJRQQSA-N |
| XLogP | 7.84 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.61 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|