C31H43NO5 — CID 136865543
10-[3-hydroxy-4-[(4-pentoxyphenyl)iminomethyl]phenoxy]decyl prop-2-enoate (PubChem CID 136865543) has the molecular formula C31H43NO5 and a molecular weight of 509.69 g/mol. Its IUPAC name is 10-[3-hydroxy-4-[(4-pentoxyphenyl)iminomethyl]phenoxy]decyl prop-2-enoate.
| Compound Name | 10-[3-hydroxy-4-[(4-pentoxyphenyl)iminomethyl]phenoxy]decyl prop-2-enoate |
|---|---|
| PubChem CID | 136865543 |
| Molecular Formula | C31H43NO5 |
| Molecular Weight | 509.69 g/mol |
| Exact Mass | 509.31 |
| IUPAC Name | 10-[3-hydroxy-4-[(4-pentoxyphenyl)iminomethyl]phenoxy]decyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCCCCCOc1ccc(/C=N/c2ccc(OCCCCC)cc2)c(O)c1 |
| InChI | InChI=1S/C31H43NO5/c1-3-5-12-21-35-28-19-16-27(17-20-28)32-25-26-15-18-29(24-30(26)33)36-22-13-10-8-6-7-9-11-14-23-37-31(34)4-2/h4,15-20,24-25,33H,2-3,5-14,21-23H2,1H3/b32-25+ |
| InChIKey | JEOIJNBRJVKRKR-WGPBWIAQSA-N |
| XLogP | 7.94 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.69 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|