C31H43NO4 — CID 102071842
6-[4-[(4-nonoxyphenyl)iminomethyl]phenoxy]hexyl prop-2-enoate (PubChem CID 102071842) has the molecular formula C31H43NO4 and a molecular weight of 493.69 g/mol. Its IUPAC name is 6-[4-[(4-nonoxyphenyl)iminomethyl]phenoxy]hexyl prop-2-enoate.
| Compound Name | 6-[4-[(4-nonoxyphenyl)iminomethyl]phenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 102071842 |
| Molecular Formula | C31H43NO4 |
| Molecular Weight | 493.69 g/mol |
| Exact Mass | 493.32 |
| IUPAC Name | 6-[4-[(4-nonoxyphenyl)iminomethyl]phenoxy]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(/C=N/c2ccc(OCCCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C31H43NO4/c1-3-5-6-7-8-9-12-23-35-30-21-17-28(18-22-30)32-26-27-15-19-29(20-16-27)34-24-13-10-11-14-25-36-31(33)4-2/h4,15-22,26H,2-3,5-14,23-25H2,1H3/b32-26+ |
| InChIKey | JBZZHKLRYSAUIY-HMZBKAONSA-N |
| XLogP | 8.23 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.69 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|