C33H40N4O3 — CID 20721764
7-[4-[[4-[(6-pentylpyridazin-3-yl)iminomethyl]phenyl]methylideneamino]phenoxy]heptyl prop-2-enoate (PubChem CID 20721764) has the molecular formula C33H40N4O3 and a molecular weight of 540.71 g/mol. Its IUPAC name is 7-[4-[[4-[(6-pentylpyridazin-3-yl)iminomethyl]phenyl]methylideneamino]phenoxy]heptyl prop-2-enoate.
| Compound Name | 7-[4-[[4-[(6-pentylpyridazin-3-yl)iminomethyl]phenyl]methylideneamino]phenoxy]heptyl prop-2-enoate |
|---|---|
| PubChem CID | 20721764 |
| Molecular Formula | C33H40N4O3 |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | 7-[4-[[4-[(6-pentylpyridazin-3-yl)iminomethyl]phenyl]methylideneamino]phenoxy]heptyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCCOc1ccc(/N=C/c2ccc(/C=N/c3ccc(CCCCC)nn3)cc2)cc1 |
| InChI | InChI=1S/C33H40N4O3/c1-3-5-9-12-30-19-22-32(37-36-30)35-26-28-15-13-27(14-16-28)25-34-29-17-20-31(21-18-29)39-23-10-7-6-8-11-24-40-33(38)4-2/h4,13-22,25-26H,2-3,5-12,23-24H2,1H3/b34-25+,35-26+ |
| InChIKey | IYDBMZFMMQRABF-UVYDVINMSA-N |
| XLogP | 7.77 |
| TPSA | 86.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|