C26H37NO3 — CID 136805594
2-[(4-octoxyphenyl)iminomethyl]-5-pentoxyphenol (PubChem CID 136805594) has the molecular formula C26H37NO3 and a molecular weight of 411.59 g/mol. Its IUPAC name is 2-[(4-octoxyphenyl)iminomethyl]-5-pentoxyphenol.
| Compound Name | 2-[(4-octoxyphenyl)iminomethyl]-5-pentoxyphenol |
|---|---|
| PubChem CID | 136805594 |
| Molecular Formula | C26H37NO3 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | 2-[(4-octoxyphenyl)iminomethyl]-5-pentoxyphenol |
| SMILES | CCCCCCCCOc1ccc(/N=C/c2ccc(OCCCCC)cc2O)cc1 |
| InChI | InChI=1S/C26H37NO3/c1-3-5-7-8-9-11-19-29-24-16-13-23(14-17-24)27-21-22-12-15-25(20-26(22)28)30-18-10-6-4-2/h12-17,20-21,28H,3-11,18-19H2,1-2H3/b27-21+ |
| InChIKey | VQWKRZAPFZUVOQ-SZXQPVLSSA-N |
| XLogP | 7.45 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|