C43H71NO4 — CID 136801601
5-decoxy-2-[(3,4-didecoxyphenyl)iminomethyl]phenol (PubChem CID 136801601) has the molecular formula C43H71NO4 and a molecular weight of 666.04 g/mol. Its IUPAC name is 5-decoxy-2-[(3,4-didecoxyphenyl)iminomethyl]phenol.
| Compound Name | 5-decoxy-2-[(3,4-didecoxyphenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 136801601 |
| Molecular Formula | C43H71NO4 |
| Molecular Weight | 666.04 g/mol |
| Exact Mass | 665.54 |
| IUPAC Name | 5-decoxy-2-[(3,4-didecoxyphenyl)iminomethyl]phenol |
| SMILES | CCCCCCCCCCOc1ccc(/C=N/c2ccc(OCCCCCCCCCC)c(OCCCCCCCCCC)c2)c(O)c1 |
| InChI | InChI=1S/C43H71NO4/c1-4-7-10-13-16-19-22-25-32-46-40-30-28-38(41(45)36-40)37-44-39-29-31-42(47-33-26-23-20-17-14-11-8-5-2)43(35-39)48-34-27-24-21-18-15-12-9-6-3/h28-31,35-37,45H,4-27,32-34H2,1-3H3/b44-37+ |
| InChIKey | BFCRKTMVHSIPKI-QDIWCCNHSA-N |
| XLogP | 13.70 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.04 |
| LogP ≤ 5 | 13.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|