C25H35NO2 — CID 4594157
5-hexoxy-2-[(4-hexylphenyl)iminomethyl]phenol (PubChem CID 4594157) has the molecular formula C25H35NO2 and a molecular weight of 381.56 g/mol. Its IUPAC name is 5-hexoxy-2-[(4-hexylphenyl)iminomethyl]phenol.
| Compound Name | 5-hexoxy-2-[(4-hexylphenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 4594157 |
| Molecular Formula | C25H35NO2 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | 5-hexoxy-2-[(4-hexylphenyl)iminomethyl]phenol |
| SMILES | CCCCCCOc1ccc(/C=N/c2ccc(CCCCCC)cc2)c(O)c1 |
| InChI | InChI=1S/C25H35NO2/c1-3-5-7-9-11-21-12-15-23(16-13-21)26-20-22-14-17-24(19-25(22)27)28-18-10-8-6-4-2/h12-17,19-20,27H,3-11,18H2,1-2H3/b26-20+ |
| InChIKey | SRDBXBLEAALBRE-LHLOQNFPSA-N |
| XLogP | 7.22 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|