C27H16Cl2N2O3 — CID 3098512
[4-[(2-phenyl-1,3-benzoxazol-5-yl)iminomethyl]phenyl] 2,4-dichlorobenzoate (PubChem CID 3098512) has the molecular formula C27H16Cl2N2O3 and a molecular weight of 487.34 g/mol. Its IUPAC name is [4-[(2-phenyl-1,3-benzoxazol-5-yl)iminomethyl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [4-[(2-phenyl-1,3-benzoxazol-5-yl)iminomethyl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 3098512 |
| Molecular Formula | C27H16Cl2N2O3 |
| Molecular Weight | 487.34 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | [4-[(2-phenyl-1,3-benzoxazol-5-yl)iminomethyl]phenyl] 2,4-dichlorobenzoate |
| SMILES | O=C(Oc1ccc(/C=N/c2ccc3oc(-c4ccccc4)nc3c2)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H16Cl2N2O3/c28-19-8-12-22(23(29)14-19)27(32)33-21-10-6-17(7-11-21)16-30-20-9-13-25-24(15-20)31-26(34-25)18-4-2-1-3-5-18/h1-16H/b30-16+ |
| InChIKey | HNKSTSOKYCTYPP-OKCVXOCRSA-N |
| XLogP | 7.77 |
| TPSA | 64.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.34 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|