C20H10Cl4N2O — CID 3978136
1-(3,4-dichlorophenyl)-N-[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]methanimine (PubChem CID 3978136) has the molecular formula C20H10Cl4N2O and a molecular weight of 436.13 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-N-[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]methanimine.
| Compound Name | 1-(3,4-dichlorophenyl)-N-[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]methanimine |
|---|---|
| PubChem CID | 3978136 |
| Molecular Formula | C20H10Cl4N2O |
| Molecular Weight | 436.13 g/mol |
| Exact Mass | 433.95 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-N-[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]methanimine |
| SMILES | Clc1ccc(-c2nc3cc(/N=C/c4ccc(Cl)c(Cl)c4)ccc3o2)c(Cl)c1 |
| InChI | InChI=1S/C20H10Cl4N2O/c21-12-2-4-14(16(23)8-12)20-26-18-9-13(3-6-19(18)27-20)25-10-11-1-5-15(22)17(24)7-11/h1-10H/b25-10+ |
| InChIKey | FPXSCLMXNUFIHV-KIBLKLHPSA-N |
| XLogP | 7.86 |
| TPSA | 38.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.13 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|