C21H13BrClFN2O2 — CID 3451539
1-(3-bromo-4-methoxyphenyl)-N-[2-(2-chloro-4-fluorophenyl)-1,3-benzoxazol-5-yl]methanimine (PubChem CID 3451539) has the molecular formula C21H13BrClFN2O2 and a molecular weight of 459.70 g/mol. Its IUPAC name is 1-(3-bromo-4-methoxyphenyl)-N-[2-(2-chloro-4-fluorophenyl)-1,3-benzoxazol-5-yl]methanimine.
| Compound Name | 1-(3-bromo-4-methoxyphenyl)-N-[2-(2-chloro-4-fluorophenyl)-1,3-benzoxazol-5-yl]methanimine |
|---|---|
| PubChem CID | 3451539 |
| Molecular Formula | C21H13BrClFN2O2 |
| Molecular Weight | 459.70 g/mol |
| Exact Mass | 457.98 |
| IUPAC Name | 1-(3-bromo-4-methoxyphenyl)-N-[2-(2-chloro-4-fluorophenyl)-1,3-benzoxazol-5-yl]methanimine |
| SMILES | COc1ccc(/C=N/c2ccc3oc(-c4ccc(F)cc4Cl)nc3c2)cc1Br |
| InChI | InChI=1S/C21H13BrClFN2O2/c1-27-19-6-2-12(8-16(19)22)11-25-14-4-7-20-18(10-14)26-21(28-20)15-5-3-13(24)9-17(15)23/h2-11H,1H3/b25-11+ |
| InChIKey | WNHSPBSYRFATHW-OPEKNORGSA-N |
| XLogP | 6.81 |
| TPSA | 47.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.70 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|