C21H15FN2O3 — CID 4183148
2-[[2-(3-fluorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-6-methoxyphenol (PubChem CID 4183148) has the molecular formula C21H15FN2O3 and a molecular weight of 362.36 g/mol. Its IUPAC name is 2-[[2-(3-fluorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-6-methoxyphenol.
| Compound Name | 2-[[2-(3-fluorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 4183148 |
| Molecular Formula | C21H15FN2O3 |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 2-[[2-(3-fluorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-6-methoxyphenol |
| SMILES | COc1cccc(/C=N/c2ccc3oc(-c4cccc(F)c4)nc3c2)c1O |
| InChI | InChI=1S/C21H15FN2O3/c1-26-19-7-3-5-14(20(19)25)12-23-16-8-9-18-17(11-16)24-21(27-18)13-4-2-6-15(22)10-13/h2-12,25H,1H3/b23-12+ |
| InChIKey | KRWTZUKJYQBVAH-FSJBWODESA-N |
| XLogP | 5.10 |
| TPSA | 67.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|