C25H24N2O3 — CID 135633849
2-[[2-(4-tert-butylphenyl)-1,3-benzoxazol-6-yl]iminomethyl]-6-methoxyphenol (PubChem CID 135633849) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is 2-[[2-(4-tert-butylphenyl)-1,3-benzoxazol-6-yl]iminomethyl]-6-methoxyphenol.
| Compound Name | 2-[[2-(4-tert-butylphenyl)-1,3-benzoxazol-6-yl]iminomethyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 135633849 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 2-[[2-(4-tert-butylphenyl)-1,3-benzoxazol-6-yl]iminomethyl]-6-methoxyphenol |
| SMILES | COc1cccc(/C=N/c2ccc3nc(-c4ccc(C(C)(C)C)cc4)oc3c2)c1O |
| InChI | InChI=1S/C25H24N2O3/c1-25(2,3)18-10-8-16(9-11-18)24-27-20-13-12-19(14-22(20)30-24)26-15-17-6-5-7-21(29-4)23(17)28/h5-15,28H,1-4H3/b26-15+ |
| InChIKey | QDHOHYBSIZBOSF-CVKSISIWSA-N |
| XLogP | 6.26 |
| TPSA | 67.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|