C21H15N3O4 — CID 1243589
2-[[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]-6-nitrophenol (PubChem CID 1243589) has the molecular formula C21H15N3O4 and a molecular weight of 373.37 g/mol. Its IUPAC name is 2-[[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]-6-nitrophenol.
| Compound Name | 2-[[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]-6-nitrophenol |
|---|---|
| PubChem CID | 1243589 |
| Molecular Formula | C21H15N3O4 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 2-[[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]-6-nitrophenol |
| SMILES | Cc1ccc2nc(-c3ccc(/N=C/c4cccc([N+](=O)[O-])c4O)cc3)oc2c1 |
| InChI | InChI=1S/C21H15N3O4/c1-13-5-10-17-19(11-13)28-21(23-17)14-6-8-16(9-7-14)22-12-15-3-2-4-18(20(15)25)24(26)27/h2-12,25H,1H3/b22-12+ |
| InChIKey | FSHRWVSFIGXWKD-WSDLNYQXSA-N |
| XLogP | 5.17 |
| TPSA | 101.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|