C20H11FN3O4- — CID 7035727
2-[[2-(3-fluorophenyl)-1,3-benzoxazol-6-yl]iminomethyl]-6-nitrophenolate (PubChem CID 7035727) has the molecular formula C20H11FN3O4- and a molecular weight of 376.32 g/mol. Its IUPAC name is 2-[[2-(3-fluorophenyl)-1,3-benzoxazol-6-yl]iminomethyl]-6-nitrophenolate.
| Compound Name | 2-[[2-(3-fluorophenyl)-1,3-benzoxazol-6-yl]iminomethyl]-6-nitrophenolate |
|---|---|
| PubChem CID | 7035727 |
| Molecular Formula | C20H11FN3O4- |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 2-[[2-(3-fluorophenyl)-1,3-benzoxazol-6-yl]iminomethyl]-6-nitrophenolate |
| SMILES | O=[N+]([O-])c1cccc(/C=N/c2ccc3nc(-c4cccc(F)c4)oc3c2)c1[O-] |
| InChI | InChI=1S/C20H12FN3O4/c21-14-5-1-3-12(9-14)20-23-16-8-7-15(10-18(16)28-20)22-11-13-4-2-6-17(19(13)25)24(26)27/h1-11,25H/p-1/b22-11+ |
| InChIKey | SXUNUVLVMNWZPG-SSDVNMTOSA-M |
| XLogP | 4.37 |
| TPSA | 104.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|