C20H11Br2N3O3 — CID 3538570
1-(4-bromo-3-nitrophenyl)-N-[2-(4-bromophenyl)-1,3-benzoxazol-6-yl]methanimine (PubChem CID 3538570) has the molecular formula C20H11Br2N3O3 and a molecular weight of 501.13 g/mol. Its IUPAC name is 1-(4-bromo-3-nitrophenyl)-N-[2-(4-bromophenyl)-1,3-benzoxazol-6-yl]methanimine.
| Compound Name | 1-(4-bromo-3-nitrophenyl)-N-[2-(4-bromophenyl)-1,3-benzoxazol-6-yl]methanimine |
|---|---|
| PubChem CID | 3538570 |
| Molecular Formula | C20H11Br2N3O3 |
| Molecular Weight | 501.13 g/mol |
| Exact Mass | 498.92 |
| IUPAC Name | 1-(4-bromo-3-nitrophenyl)-N-[2-(4-bromophenyl)-1,3-benzoxazol-6-yl]methanimine |
| SMILES | O=[N+]([O-])c1cc(/C=N/c2ccc3nc(-c4ccc(Br)cc4)oc3c2)ccc1Br |
| InChI | InChI=1S/C20H11Br2N3O3/c21-14-4-2-13(3-5-14)20-24-17-8-6-15(10-19(17)28-20)23-11-12-1-7-16(22)18(9-12)25(26)27/h1-11H/b23-11+ |
| InChIKey | YIOODLBXSFRCQE-FOKLQQMPSA-N |
| XLogP | 6.68 |
| TPSA | 81.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.13 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|