C21H14BrN3O3 — CID 4180598
1-(4-bromo-3-nitrophenyl)-N-[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]methanimine (PubChem CID 4180598) has the molecular formula C21H14BrN3O3 and a molecular weight of 436.27 g/mol. Its IUPAC name is 1-(4-bromo-3-nitrophenyl)-N-[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]methanimine.
| Compound Name | 1-(4-bromo-3-nitrophenyl)-N-[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]methanimine |
|---|---|
| PubChem CID | 4180598 |
| Molecular Formula | C21H14BrN3O3 |
| Molecular Weight | 436.27 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | 1-(4-bromo-3-nitrophenyl)-N-[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]methanimine |
| SMILES | Cc1ccc2oc(-c3cccc(/N=C/c4ccc(Br)c([N+](=O)[O-])c4)c3)nc2c1 |
| InChI | InChI=1S/C21H14BrN3O3/c1-13-5-8-20-18(9-13)24-21(28-20)15-3-2-4-16(11-15)23-12-14-6-7-17(22)19(10-14)25(26)27/h2-12H,1H3/b23-12+ |
| InChIKey | KUPMWNABOZZGDZ-FSJBWODESA-N |
| XLogP | 6.22 |
| TPSA | 81.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.27 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|