C24H20BrN3O4 — CID 137129387
2-bromo-6-[[3-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]iminomethyl]-4-nitrophenol (PubChem CID 137129387) has the molecular formula C24H20BrN3O4 and a molecular weight of 494.35 g/mol. Its IUPAC name is 2-bromo-6-[[3-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]iminomethyl]-4-nitrophenol.
| Compound Name | 2-bromo-6-[[3-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]iminomethyl]-4-nitrophenol |
|---|---|
| PubChem CID | 137129387 |
| Molecular Formula | C24H20BrN3O4 |
| Molecular Weight | 494.35 g/mol |
| Exact Mass | 493.06 |
| IUPAC Name | 2-bromo-6-[[3-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]iminomethyl]-4-nitrophenol |
| SMILES | CC[C@H](C)c1ccc2oc(-c3cccc(/N=C/c4cc([N+](=O)[O-])cc(Br)c4O)c3)nc2c1 |
| InChI | InChI=1S/C24H20BrN3O4/c1-3-14(2)15-7-8-22-21(11-15)27-24(32-22)16-5-4-6-18(9-16)26-13-17-10-19(28(30)31)12-20(25)23(17)29/h4-14,29H,3H2,1-2H3/b26-13+/t14-/m0/s1 |
| InChIKey | OMWDGBHPFKMFMF-JUCPORTRSA-N |
| XLogP | 7.14 |
| TPSA | 101.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.35 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|