C24H21N3O5 — CID 1048656
2-ethoxy-6-[[2-(4-ethylphenyl)-1,3-benzoxazol-5-yl]iminomethyl]-4-nitrophenol (PubChem CID 1048656) has the molecular formula C24H21N3O5 and a molecular weight of 431.45 g/mol. Its IUPAC name is 2-ethoxy-6-[[2-(4-ethylphenyl)-1,3-benzoxazol-5-yl]iminomethyl]-4-nitrophenol.
| Compound Name | 2-ethoxy-6-[[2-(4-ethylphenyl)-1,3-benzoxazol-5-yl]iminomethyl]-4-nitrophenol |
|---|---|
| PubChem CID | 1048656 |
| Molecular Formula | C24H21N3O5 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 2-ethoxy-6-[[2-(4-ethylphenyl)-1,3-benzoxazol-5-yl]iminomethyl]-4-nitrophenol |
| SMILES | CCOc1cc([N+](=O)[O-])cc(/C=N/c2ccc3oc(-c4ccc(CC)cc4)nc3c2)c1O |
| InChI | InChI=1S/C24H21N3O5/c1-3-15-5-7-16(8-6-15)24-26-20-12-18(9-10-21(20)32-24)25-14-17-11-19(27(29)30)13-22(23(17)28)31-4-2/h5-14,28H,3-4H2,1-2H3/b25-14+ |
| InChIKey | GVJWOAQHORDAQX-AFUMVMLFSA-N |
| XLogP | 5.82 |
| TPSA | 110.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|