C22H14ClF2N3O5 — CID 135810571
2-[[2-(2-chloro-4,5-difluorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-6-ethoxy-4-nitrophenol (PubChem CID 135810571) has the molecular formula C22H14ClF2N3O5 and a molecular weight of 473.82 g/mol. Its IUPAC name is 2-[[2-(2-chloro-4,5-difluorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-6-ethoxy-4-nitrophenol.
| Compound Name | 2-[[2-(2-chloro-4,5-difluorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-6-ethoxy-4-nitrophenol |
|---|---|
| PubChem CID | 135810571 |
| Molecular Formula | C22H14ClF2N3O5 |
| Molecular Weight | 473.82 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | 2-[[2-(2-chloro-4,5-difluorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-6-ethoxy-4-nitrophenol |
| SMILES | CCOc1cc([N+](=O)[O-])cc(/C=N/c2ccc3oc(-c4cc(F)c(F)cc4Cl)nc3c2)c1O |
| InChI | InChI=1S/C22H14ClF2N3O5/c1-2-32-20-7-13(28(30)31)5-11(21(20)29)10-26-12-3-4-19-18(6-12)27-22(33-19)14-8-16(24)17(25)9-15(14)23/h3-10,29H,2H2,1H3/b26-10+ |
| InChIKey | ACSITWWQFFJTJI-NSKAYECMSA-N |
| XLogP | 6.19 |
| TPSA | 110.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.82 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|