C22H14Cl2F2N2O3 — CID 135810569
4-chloro-2-[[2-(2-chloro-4,5-difluorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-6-ethoxyphenol (PubChem CID 135810569) has the molecular formula C22H14Cl2F2N2O3 and a molecular weight of 463.27 g/mol. Its IUPAC name is 4-chloro-2-[[2-(2-chloro-4,5-difluorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-6-ethoxyphenol.
| Compound Name | 4-chloro-2-[[2-(2-chloro-4,5-difluorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-6-ethoxyphenol |
|---|---|
| PubChem CID | 135810569 |
| Molecular Formula | C22H14Cl2F2N2O3 |
| Molecular Weight | 463.27 g/mol |
| Exact Mass | 462.03 |
| IUPAC Name | 4-chloro-2-[[2-(2-chloro-4,5-difluorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-6-ethoxyphenol |
| SMILES | CCOc1cc(Cl)cc(/C=N/c2ccc3oc(-c4cc(F)c(F)cc4Cl)nc3c2)c1O |
| InChI | InChI=1S/C22H14Cl2F2N2O3/c1-2-30-20-6-12(23)5-11(21(20)29)10-27-13-3-4-19-18(7-13)28-22(31-19)14-8-16(25)17(26)9-15(14)24/h3-10,29H,2H2,1H3/b27-10+ |
| InChIKey | HQVSPYGDWPTAHO-YPXUMCKCSA-N |
| XLogP | 6.93 |
| TPSA | 67.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.27 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|