C21H15ClN2O4 — CID 1101470
2-[[4-(5-chloro-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]iminomethyl]-6-methoxyphenol (PubChem CID 1101470) has the molecular formula C21H15ClN2O4 and a molecular weight of 394.81 g/mol. Its IUPAC name is 2-[[4-(5-chloro-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]iminomethyl]-6-methoxyphenol.
| Compound Name | 2-[[4-(5-chloro-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]iminomethyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 1101470 |
| Molecular Formula | C21H15ClN2O4 |
| Molecular Weight | 394.81 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 2-[[4-(5-chloro-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]iminomethyl]-6-methoxyphenol |
| SMILES | COc1cccc(/C=N/c2ccc(-c3nc4cc(Cl)ccc4o3)c(O)c2)c1O |
| InChI | InChI=1S/C21H15ClN2O4/c1-27-19-4-2-3-12(20(19)26)11-23-14-6-7-15(17(25)10-14)21-24-16-9-13(22)5-8-18(16)28-21/h2-11,25-26H,1H3/b23-11+ |
| InChIKey | JHTFUCCQUODCFU-FOKLQQMPSA-N |
| XLogP | 5.32 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.81 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|