C21H14Cl2N2O2 — CID 5185978
5-[(2,5-dichlorophenyl)methylideneamino]-2-(6-methyl-1,3-benzoxazol-2-yl)phenol (PubChem CID 5185978) has the molecular formula C21H14Cl2N2O2 and a molecular weight of 397.26 g/mol. Its IUPAC name is 5-[(2,5-dichlorophenyl)methylideneamino]-2-(6-methyl-1,3-benzoxazol-2-yl)phenol.
| Compound Name | 5-[(2,5-dichlorophenyl)methylideneamino]-2-(6-methyl-1,3-benzoxazol-2-yl)phenol |
|---|---|
| PubChem CID | 5185978 |
| Molecular Formula | C21H14Cl2N2O2 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 5-[(2,5-dichlorophenyl)methylideneamino]-2-(6-methyl-1,3-benzoxazol-2-yl)phenol |
| SMILES | Cc1ccc2nc(-c3ccc(/N=C/c4cc(Cl)ccc4Cl)cc3O)oc2c1 |
| InChI | InChI=1S/C21H14Cl2N2O2/c1-12-2-7-18-20(8-12)27-21(25-18)16-5-4-15(10-19(16)26)24-11-13-9-14(22)3-6-17(13)23/h2-11,26H,1H3/b24-11+ |
| InChIKey | WEPMZEZWKKFKAN-BHGWPJFGSA-N |
| XLogP | 6.57 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|