About 5-[(2,5-dichlorophenyl)methylideneamino]-2-(6-methyl-1,3-benzoxazol-2-yl)phenol
5-[(2,5-dichlorophenyl)methylideneamino]-2-(6-methyl-1,3-benzoxazol-2-yl)phenol (PubChem CID 5185978) has the molecular formula C21H14Cl2N2O2
and a molecular weight of 397.26 g/mol. Its IUPAC name is 5-[(2,5-dichlorophenyl)methylideneamino]-2-(6-methyl-1,3-benzoxazol-2-yl)phenol.
Molecular Properties
| Compound Name | 5-[(2,5-dichlorophenyl)methylideneamino]-2-(6-methyl-1,3-benzoxazol-2-yl)phenol |
| PubChem CID | 5185978 |
| Molecular Formula | C21H14Cl2N2O2 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 5-[(2,5-dichlorophenyl)methylideneamino]-2-(6-methyl-1,3-benzoxazol-2-yl)phenol |
| SMILES | Cc1ccc2nc(-c3ccc(/N=C/c4cc(Cl)ccc4Cl)cc3O)oc2c1 |
| InChI | InChI=1S/C21H14Cl2N2O2/c1-12-2-7-18-20(8-12)27-21(25-18)16-5-4-15(10-19(16)26)24-11-13-9-14(22)3-6-17(13)23/h2-11,26H,1H3/b24-11+ |
| InChIKey | WEPMZEZWKKFKAN-BHGWPJFGSA-N |
| XLogP | 6.57 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2,5-dichlorophenyl)methylideneamino]-2-(6-methyl-1,3-benzoxazol-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,5-dichlorophenyl)methylideneamino]-2-(6-methyl-1,3-benzoxazol-2-yl)phenol?
The IUPAC name of 5-[(2,5-dichlorophenyl)methylideneamino]-2-(6-methyl-1,3-benzoxazol-2-yl)phenol (CID 5185978) is 5-[(2,5-dichlorophenyl)methylideneamino]-2-(6-methyl-1,3-benzoxazol-2-yl)phenol.
What is the SMILES notation for 5-[(2,5-dichlorophenyl)methylideneamino]-2-(6-methyl-1,3-benzoxazol-2-yl)phenol?
The canonical SMILES for 5-[(2,5-dichlorophenyl)methylideneamino]-2-(6-methyl-1,3-benzoxazol-2-yl)phenol is Cc1ccc2nc(-c3ccc(/N=C/c4cc(Cl)ccc4Cl)cc3O)oc2c1.
What is the InChIKey of 5-[(2,5-dichlorophenyl)methylideneamino]-2-(6-methyl-1,3-benzoxazol-2-yl)phenol?
The InChIKey is WEPMZEZWKKFKAN-BHGWPJFGSA-N. The full InChI is InChI=1S/C21H14Cl2N2O2/c1-12-2-7-18-20(8-12)27-21(25-18)16-5-4-15(10-19(16)26)24-11-13-9-14(22)3-6-17(13)23/h2-11,26H,1H3/b24-11+.
What are the key properties of 5-[(2,5-dichlorophenyl)methylideneamino]-2-(6-methyl-1,3-benzoxazol-2-yl)phenol?
5-[(2,5-dichlorophenyl)methylideneamino]-2-(6-methyl-1,3-benzoxazol-2-yl)phenol has a molecular weight of 397.26 g/mol, XLogP of 6.57, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,5-dichlorophenyl)methylideneamino]-2-(6-methyl-1,3-benzoxazol-2-yl)phenol is sourced from PubChem (CID 5185978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).