C21H15ClN2O3 — CID 135779414
4-[[4-chloro-3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]benzene-1,3-diol (PubChem CID 135779414) has the molecular formula C21H15ClN2O3 and a molecular weight of 378.82 g/mol. Its IUPAC name is 4-[[4-chloro-3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]benzene-1,3-diol.
| Compound Name | 4-[[4-chloro-3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 135779414 |
| Molecular Formula | C21H15ClN2O3 |
| Molecular Weight | 378.82 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 4-[[4-chloro-3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]benzene-1,3-diol |
| SMILES | Cc1ccc2nc(-c3cc(/N=C/c4ccc(O)cc4O)ccc3Cl)oc2c1 |
| InChI | InChI=1S/C21H15ClN2O3/c1-12-2-7-18-20(8-12)27-21(24-18)16-9-14(4-6-17(16)22)23-11-13-3-5-15(25)10-19(13)26/h2-11,25-26H,1H3/b23-11+ |
| InChIKey | PEKCKVBTEXXABJ-FOKLQQMPSA-N |
| XLogP | 5.62 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.82 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|