C13H9NO4 — CID 135522275
4-(6-hydroxy-1,3-benzoxazol-2-yl)benzene-1,3-diol (PubChem CID 135522275) has the molecular formula C13H9NO4 and a molecular weight of 243.22 g/mol. Its IUPAC name is 4-(6-hydroxy-1,3-benzoxazol-2-yl)benzene-1,3-diol.
| Compound Name | 4-(6-hydroxy-1,3-benzoxazol-2-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 135522275 |
| Molecular Formula | C13H9NO4 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 4-(6-hydroxy-1,3-benzoxazol-2-yl)benzene-1,3-diol |
| SMILES | Oc1ccc(-c2nc3ccc(O)cc3o2)c(O)c1 |
| InChI | InChI=1S/C13H9NO4/c15-7-1-3-9(11(17)5-7)13-14-10-4-2-8(16)6-12(10)18-13/h1-6,15-17H |
| InChIKey | FLDXQSCXJKEXJF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |