C14H8N2O2 — CID 165357068
4-(1,3-benzoxazol-2-yl)-3-hydroxybenzonitrile (PubChem CID 165357068) has the molecular formula C14H8N2O2 and a molecular weight of 236.23 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-2-yl)-3-hydroxybenzonitrile.
| Compound Name | 4-(1,3-benzoxazol-2-yl)-3-hydroxybenzonitrile |
|---|---|
| PubChem CID | 165357068 |
| Molecular Formula | C14H8N2O2 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 4-(1,3-benzoxazol-2-yl)-3-hydroxybenzonitrile |
| SMILES | N#Cc1ccc(-c2nc3ccccc3o2)c(O)c1 |
| InChI | InChI=1S/C14H8N2O2/c15-8-9-5-6-10(12(17)7-9)14-16-11-3-1-2-4-13(11)18-14/h1-7,17H |
| InChIKey | CMDNAOKKAFEDRN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 70.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |