C12H6N2OS — CID 126512961
5-(1,3-benzoxazol-2-yl)thiophene-3-carbonitrile (PubChem CID 126512961) has the molecular formula C12H6N2OS and a molecular weight of 226.26 g/mol. Its IUPAC name is 5-(1,3-benzoxazol-2-yl)thiophene-3-carbonitrile.
| Compound Name | 5-(1,3-benzoxazol-2-yl)thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 126512961 |
| Molecular Formula | C12H6N2OS |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.02 |
| IUPAC Name | 5-(1,3-benzoxazol-2-yl)thiophene-3-carbonitrile |
| SMILES | N#Cc1csc(-c2nc3ccccc3o2)c1 |
| InChI | InChI=1S/C12H6N2OS/c13-6-8-5-11(16-7-8)12-14-9-3-1-2-4-10(9)15-12/h1-5,7H |
| InChIKey | XERFYWJUHOIIAE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |