C15H11NOS2 — CID 174523834
thiophene;2-thiophen-2-yl-1,3-benzoxazole (PubChem CID 174523834) has the molecular formula C15H11NOS2 and a molecular weight of 285.39 g/mol. Its IUPAC name is thiophene;2-thiophen-2-yl-1,3-benzoxazole.
| Compound Name | thiophene;2-thiophen-2-yl-1,3-benzoxazole |
|---|---|
| PubChem CID | 174523834 |
| Molecular Formula | C15H11NOS2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | thiophene;2-thiophen-2-yl-1,3-benzoxazole |
| SMILES | c1ccsc1.c1csc(-c2nc3ccccc3o2)c1 |
| InChI | InChI=1S/C11H7NOS.C4H4S/c1-2-5-9-8(4-1)12-11(13-9)10-6-3-7-14-10;1-2-4-5-3-1/h1-7H;1-4H |
| InChIKey | WQLWXPNHCMRUEY-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |