C11H6FNOS — CID 102366712
5-fluoro-2-thiophen-2-yl-1,3-benzoxazole (PubChem CID 102366712) has the molecular formula C11H6FNOS and a molecular weight of 219.24 g/mol. Its IUPAC name is 5-fluoro-2-thiophen-2-yl-1,3-benzoxazole.
| Compound Name | 5-fluoro-2-thiophen-2-yl-1,3-benzoxazole |
|---|---|
| PubChem CID | 102366712 |
| Molecular Formula | C11H6FNOS |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | 5-fluoro-2-thiophen-2-yl-1,3-benzoxazole |
| SMILES | Fc1ccc2oc(-c3cccs3)nc2c1 |
| InChI | InChI=1S/C11H6FNOS/c12-7-3-4-9-8(6-7)13-11(14-9)10-2-1-5-15-10/h1-6H |
| InChIKey | VIYDBKDEERGIGW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |