C11H7FN2O — CID 137012756
5-fluoro-2-(1H-pyrrol-2-yl)-1,3-benzoxazole (PubChem CID 137012756) has the molecular formula C11H7FN2O and a molecular weight of 202.19 g/mol. Its IUPAC name is 5-fluoro-2-(1H-pyrrol-2-yl)-1,3-benzoxazole.
| Compound Name | 5-fluoro-2-(1H-pyrrol-2-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 137012756 |
| Molecular Formula | C11H7FN2O |
| Molecular Weight | 202.19 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | 5-fluoro-2-(1H-pyrrol-2-yl)-1,3-benzoxazole |
| SMILES | Fc1ccc2oc(-c3ccc[nH]3)nc2c1 |
| InChI | InChI=1S/C11H7FN2O/c12-7-3-4-10-9(6-7)14-11(15-10)8-2-1-5-13-8/h1-6,13H |
| InChIKey | KISFVKAVPHCFKN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.19 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |