C14H11FN2O — CID 91676646
2-(3-fluorophenyl)-N-methyl-1,3-benzoxazol-5-amine (PubChem CID 91676646) has the molecular formula C14H11FN2O and a molecular weight of 242.25 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-N-methyl-1,3-benzoxazol-5-amine.
| Compound Name | 2-(3-fluorophenyl)-N-methyl-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 91676646 |
| Molecular Formula | C14H11FN2O |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2-(3-fluorophenyl)-N-methyl-1,3-benzoxazol-5-amine |
| SMILES | CNc1ccc2oc(-c3cccc(F)c3)nc2c1 |
| InChI | InChI=1S/C14H11FN2O/c1-16-11-5-6-13-12(8-11)17-14(18-13)9-3-2-4-10(15)7-9/h2-8,16H,1H3 |
| InChIKey | OBYZJMQDUMDRTO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |