C13H8FNO3S — CID 174517894
2-(3-fluorophenyl)-1,3-benzoxazole-5-sulfinic acid (PubChem CID 174517894) has the molecular formula C13H8FNO3S and a molecular weight of 277.28 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-1,3-benzoxazole-5-sulfinic acid.
| Compound Name | 2-(3-fluorophenyl)-1,3-benzoxazole-5-sulfinic acid |
|---|---|
| PubChem CID | 174517894 |
| Molecular Formula | C13H8FNO3S |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 2-(3-fluorophenyl)-1,3-benzoxazole-5-sulfinic acid |
| SMILES | O=S(O)c1ccc2oc(-c3cccc(F)c3)nc2c1 |
| InChI | InChI=1S/C13H8FNO3S/c14-9-3-1-2-8(6-9)13-15-11-7-10(19(16)17)4-5-12(11)18-13/h1-7H,(H,16,17) |
| InChIKey | VNWTYDTUBVFJLO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|