C19H12FNO2 — CID 155757362
4-[2-(3-fluorophenyl)-1,3-benzoxazol-6-yl]phenol (PubChem CID 155757362) has the molecular formula C19H12FNO2 and a molecular weight of 305.31 g/mol. Its IUPAC name is 4-[2-(3-fluorophenyl)-1,3-benzoxazol-6-yl]phenol.
| Compound Name | 4-[2-(3-fluorophenyl)-1,3-benzoxazol-6-yl]phenol |
|---|---|
| PubChem CID | 155757362 |
| Molecular Formula | C19H12FNO2 |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 4-[2-(3-fluorophenyl)-1,3-benzoxazol-6-yl]phenol |
| SMILES | Oc1ccc(-c2ccc3nc(-c4cccc(F)c4)oc3c2)cc1 |
| InChI | InChI=1S/C19H12FNO2/c20-15-3-1-2-14(10-15)19-21-17-9-6-13(11-18(17)23-19)12-4-7-16(22)8-5-12/h1-11,22H |
| InChIKey | POFSWVOMBQPVOZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |