C40H26N2O2 — CID 23146226
6-phenyl-2-[4-[(E)-2-[4-(6-phenyl-1,3-benzoxazol-2-yl)phenyl]ethenyl]phenyl]-1,3-benzoxazole (PubChem CID 23146226) has the molecular formula C40H26N2O2 and a molecular weight of 566.66 g/mol. Its IUPAC name is 6-phenyl-2-[4-[(E)-2-[4-(6-phenyl-1,3-benzoxazol-2-yl)phenyl]ethenyl]phenyl]-1,3-benzoxazole.
| Compound Name | 6-phenyl-2-[4-[(E)-2-[4-(6-phenyl-1,3-benzoxazol-2-yl)phenyl]ethenyl]phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 23146226 |
| Molecular Formula | C40H26N2O2 |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | 6-phenyl-2-[4-[(E)-2-[4-(6-phenyl-1,3-benzoxazol-2-yl)phenyl]ethenyl]phenyl]-1,3-benzoxazole |
| SMILES | C(=C/c1ccc(-c2nc3ccc(-c4ccccc4)cc3o2)cc1)\c1ccc(-c2nc3ccc(-c4ccccc4)cc3o2)cc1 |
| InChI | InChI=1S/C40H26N2O2/c1-3-7-29(8-4-1)33-21-23-35-37(25-33)43-39(41-35)31-17-13-27(14-18-31)11-12-28-15-19-32(20-16-28)40-42-36-24-22-34(26-38(36)44-40)30-9-5-2-6-10-30/h1-26H/b12-11+ |
| InChIKey | CMZHMDDJCNPLPF-VAWYXSNFSA-N |
| XLogP | 10.81 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|