C29H23NO — CID 6441624
5,7-dimethyl-2-[4-[(E)-2-(4-phenylphenyl)ethenyl]phenyl]-1,3-benzoxazole (PubChem CID 6441624) has the molecular formula C29H23NO and a molecular weight of 401.51 g/mol. Its IUPAC name is 5,7-dimethyl-2-[4-[(E)-2-(4-phenylphenyl)ethenyl]phenyl]-1,3-benzoxazole.
| Compound Name | 5,7-dimethyl-2-[4-[(E)-2-(4-phenylphenyl)ethenyl]phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 6441624 |
| Molecular Formula | C29H23NO |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 5,7-dimethyl-2-[4-[(E)-2-(4-phenylphenyl)ethenyl]phenyl]-1,3-benzoxazole |
| SMILES | Cc1cc(C)c2oc(-c3ccc(/C=C/c4ccc(-c5ccccc5)cc4)cc3)nc2c1 |
| InChI | InChI=1S/C29H23NO/c1-20-18-21(2)28-27(19-20)30-29(31-28)26-16-12-23(13-17-26)9-8-22-10-14-25(15-11-22)24-6-4-3-5-7-24/h3-19H,1-2H3/b9-8+ |
| InChIKey | PQKKXHAZEZTNFG-CMDGGOBGSA-N |
| XLogP | 7.95 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|