About 5,7-dimethyl-2-(1-methylpyridin-1-ium-4-yl)-1,3-benzoxazole
5,7-dimethyl-2-(1-methylpyridin-1-ium-4-yl)-1,3-benzoxazole (PubChem CID 100817845) has the molecular formula C15H15N2O+
and a molecular weight of 239.30 g/mol. Its IUPAC name is 5,7-dimethyl-2-(1-methylpyridin-1-ium-4-yl)-1,3-benzoxazole.
Molecular Properties
| Compound Name | 5,7-dimethyl-2-(1-methylpyridin-1-ium-4-yl)-1,3-benzoxazole |
| PubChem CID | 100817845 |
| Molecular Formula | C15H15N2O+ |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 5,7-dimethyl-2-(1-methylpyridin-1-ium-4-yl)-1,3-benzoxazole |
| SMILES | Cc1cc(C)c2oc(-c3cc[n+](C)cc3)nc2c1 |
| InChI | InChI=1S/C15H15N2O/c1-10-8-11(2)14-13(9-10)16-15(18-14)12-4-6-17(3)7-5-12/h4-9H,1-3H3/q+1 |
| InChIKey | HKZPGMYALBVLLK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5,7-dimethyl-2-(1-methylpyridin-1-ium-4-yl)-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethyl-2-(1-methylpyridin-1-ium-4-yl)-1,3-benzoxazole?
The IUPAC name of 5,7-dimethyl-2-(1-methylpyridin-1-ium-4-yl)-1,3-benzoxazole (CID 100817845) is 5,7-dimethyl-2-(1-methylpyridin-1-ium-4-yl)-1,3-benzoxazole.
What is the SMILES notation for 5,7-dimethyl-2-(1-methylpyridin-1-ium-4-yl)-1,3-benzoxazole?
The canonical SMILES for 5,7-dimethyl-2-(1-methylpyridin-1-ium-4-yl)-1,3-benzoxazole is Cc1cc(C)c2oc(-c3cc[n+](C)cc3)nc2c1.
What is the InChIKey of 5,7-dimethyl-2-(1-methylpyridin-1-ium-4-yl)-1,3-benzoxazole?
The InChIKey is HKZPGMYALBVLLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N2O/c1-10-8-11(2)14-13(9-10)16-15(18-14)12-4-6-17(3)7-5-12/h4-9H,1-3H3/q+1.
What are the key properties of 5,7-dimethyl-2-(1-methylpyridin-1-ium-4-yl)-1,3-benzoxazole?
5,7-dimethyl-2-(1-methylpyridin-1-ium-4-yl)-1,3-benzoxazole has a molecular weight of 239.30 g/mol, XLogP of 2.94, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethyl-2-(1-methylpyridin-1-ium-4-yl)-1,3-benzoxazole is sourced from PubChem (CID 100817845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).