C15H14BrIN2O — CID 102552407
2-(5-bromo-1-methylpyridin-1-ium-3-yl)-5,7-dimethyl-1,3-benzoxazole iodide (PubChem CID 102552407) has the molecular formula C15H14BrIN2O and a molecular weight of 445.10 g/mol. Its IUPAC name is 2-(5-bromo-1-methylpyridin-1-ium-3-yl)-5,7-dimethyl-1,3-benzoxazole iodide.
| Compound Name | 2-(5-bromo-1-methylpyridin-1-ium-3-yl)-5,7-dimethyl-1,3-benzoxazole iodide |
|---|---|
| PubChem CID | 102552407 |
| Molecular Formula | C15H14BrIN2O |
| Molecular Weight | 445.10 g/mol |
| Exact Mass | 443.93 |
| IUPAC Name | 2-(5-bromo-1-methylpyridin-1-ium-3-yl)-5,7-dimethyl-1,3-benzoxazole iodide |
| SMILES | Cc1cc(C)c2oc(-c3cc(Br)c[n+](C)c3)nc2c1.[I-] |
| InChI | InChI=1S/C15H14BrN2O.HI/c1-9-4-10(2)14-13(5-9)17-15(19-14)11-6-12(16)8-18(3)7-11;/h4-8H,1-3H3;1H/q+1;/p-1 |
| InChIKey | NRWVDAQDFAGGOV-UHFFFAOYSA-M |
| XLogP | 0.70 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.10 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|