About 2-(5-bromo-1-ethylpyridin-1-ium-3-yl)-5,7-dimethyl-1,3-benzoxazole iodide
2-(5-bromo-1-ethylpyridin-1-ium-3-yl)-5,7-dimethyl-1,3-benzoxazole iodide (PubChem CID 102552406) has the molecular formula C16H16BrIN2O
and a molecular weight of 459.13 g/mol. Its IUPAC name is 2-(5-bromo-1-ethylpyridin-1-ium-3-yl)-5,7-dimethyl-1,3-benzoxazole iodide.
Molecular Properties
| Compound Name | 2-(5-bromo-1-ethylpyridin-1-ium-3-yl)-5,7-dimethyl-1,3-benzoxazole iodide |
| PubChem CID | 102552406 |
| Molecular Formula | C16H16BrIN2O |
| Molecular Weight | 459.13 g/mol |
| Exact Mass | 457.95 |
| IUPAC Name | 2-(5-bromo-1-ethylpyridin-1-ium-3-yl)-5,7-dimethyl-1,3-benzoxazole iodide |
| SMILES | CC[n+]1cc(Br)cc(-c2nc3cc(C)cc(C)c3o2)c1.[I-] |
| InChI | InChI=1S/C16H16BrN2O.HI/c1-4-19-8-12(7-13(17)9-19)16-18-14-6-10(2)5-11(3)15(14)20-16;/h5-9H,4H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | DXSANGCJGWHKRZ-UHFFFAOYSA-M |
| XLogP | 1.19 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 459.13 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-bromo-1-ethylpyridin-1-ium-3-yl)-5,7-dimethyl-1,3-benzoxazole iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-bromo-1-ethylpyridin-1-ium-3-yl)-5,7-dimethyl-1,3-benzoxazole iodide?
The IUPAC name of 2-(5-bromo-1-ethylpyridin-1-ium-3-yl)-5,7-dimethyl-1,3-benzoxazole iodide (CID 102552406) is 2-(5-bromo-1-ethylpyridin-1-ium-3-yl)-5,7-dimethyl-1,3-benzoxazole iodide.
What is the SMILES notation for 2-(5-bromo-1-ethylpyridin-1-ium-3-yl)-5,7-dimethyl-1,3-benzoxazole iodide?
The canonical SMILES for 2-(5-bromo-1-ethylpyridin-1-ium-3-yl)-5,7-dimethyl-1,3-benzoxazole iodide is CC[n+]1cc(Br)cc(-c2nc3cc(C)cc(C)c3o2)c1.[I-].
What is the InChIKey of 2-(5-bromo-1-ethylpyridin-1-ium-3-yl)-5,7-dimethyl-1,3-benzoxazole iodide?
The InChIKey is DXSANGCJGWHKRZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H16BrN2O.HI/c1-4-19-8-12(7-13(17)9-19)16-18-14-6-10(2)5-11(3)15(14)20-16;/h5-9H,4H2,1-3H3;1H/q+1;/p-1.
What are the key properties of 2-(5-bromo-1-ethylpyridin-1-ium-3-yl)-5,7-dimethyl-1,3-benzoxazole iodide?
2-(5-bromo-1-ethylpyridin-1-ium-3-yl)-5,7-dimethyl-1,3-benzoxazole iodide has a molecular weight of 459.13 g/mol, XLogP of 1.19, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-bromo-1-ethylpyridin-1-ium-3-yl)-5,7-dimethyl-1,3-benzoxazole iodide is sourced from PubChem (CID 102552406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).