C15H15BrIN3O — CID 102552511
2-(5-bromo-1-propylpyridin-1-ium-3-yl)-1,3-benzoxazol-5-amine iodide (PubChem CID 102552511) has the molecular formula C15H15BrIN3O and a molecular weight of 460.11 g/mol. Its IUPAC name is 2-(5-bromo-1-propylpyridin-1-ium-3-yl)-1,3-benzoxazol-5-amine iodide.
| Compound Name | 2-(5-bromo-1-propylpyridin-1-ium-3-yl)-1,3-benzoxazol-5-amine iodide |
|---|---|
| PubChem CID | 102552511 |
| Molecular Formula | C15H15BrIN3O |
| Molecular Weight | 460.11 g/mol |
| Exact Mass | 458.94 |
| IUPAC Name | 2-(5-bromo-1-propylpyridin-1-ium-3-yl)-1,3-benzoxazol-5-amine iodide |
| SMILES | CCC[n+]1cc(Br)cc(-c2nc3cc(N)ccc3o2)c1.[I-] |
| InChI | InChI=1S/C15H15BrN3O.HI/c1-2-5-19-8-10(6-11(16)9-19)15-18-13-7-12(17)3-4-14(13)20-15;/h3-4,6-9H,2,5,17H2,1H3;1H/q+1;/p-1 |
| InChIKey | QOTFTIJYYKJJAE-UHFFFAOYSA-M |
| XLogP | 0.54 |
| TPSA | 55.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.11 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|