C14H12BrN3O — CID 150669523
2-[3-(aminomethyl)-4-bromophenyl]-1,3-benzoxazol-5-amine (PubChem CID 150669523) has the molecular formula C14H12BrN3O and a molecular weight of 318.17 g/mol. Its IUPAC name is 2-[3-(aminomethyl)-4-bromophenyl]-1,3-benzoxazol-5-amine.
| Compound Name | 2-[3-(aminomethyl)-4-bromophenyl]-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 150669523 |
| Molecular Formula | C14H12BrN3O |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 2-[3-(aminomethyl)-4-bromophenyl]-1,3-benzoxazol-5-amine |
| SMILES | NCc1cc(-c2nc3cc(N)ccc3o2)ccc1Br |
| InChI | InChI=1S/C14H12BrN3O/c15-11-3-1-8(5-9(11)7-16)14-18-12-6-10(17)2-4-13(12)19-14/h1-6H,7,16-17H2 |
| InChIKey | JFOTZKGXEFKZDM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|