C27H20N4O2 — CID 1160387
4-[5-[[2-(4-aminophenyl)-1,3-benzoxazol-5-yl]methyl]-1,3-benzoxazol-2-yl]aniline (PubChem CID 1160387) has the molecular formula C27H20N4O2 and a molecular weight of 432.48 g/mol. Its IUPAC name is 4-[5-[[2-(4-aminophenyl)-1,3-benzoxazol-5-yl]methyl]-1,3-benzoxazol-2-yl]aniline.
| Compound Name | 4-[5-[[2-(4-aminophenyl)-1,3-benzoxazol-5-yl]methyl]-1,3-benzoxazol-2-yl]aniline |
|---|---|
| PubChem CID | 1160387 |
| Molecular Formula | C27H20N4O2 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 4-[5-[[2-(4-aminophenyl)-1,3-benzoxazol-5-yl]methyl]-1,3-benzoxazol-2-yl]aniline |
| SMILES | Nc1ccc(-c2nc3cc(Cc4ccc5oc(-c6ccc(N)cc6)nc5c4)ccc3o2)cc1 |
| InChI | InChI=1S/C27H20N4O2/c28-20-7-3-18(4-8-20)26-30-22-14-16(1-11-24(22)32-26)13-17-2-12-25-23(15-17)31-27(33-25)19-5-9-21(29)10-6-19/h1-12,14-15H,13,28-29H2 |
| InChIKey | KFLYNILAXAHPJV-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|