C15H13ClN2O — CID 43665734
2-[4-(5-chloro-1,3-benzoxazol-2-yl)phenyl]ethanamine (PubChem CID 43665734) has the molecular formula C15H13ClN2O and a molecular weight of 272.74 g/mol. Its IUPAC name is 2-[4-(5-chloro-1,3-benzoxazol-2-yl)phenyl]ethanamine.
| Compound Name | 2-[4-(5-chloro-1,3-benzoxazol-2-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 43665734 |
| Molecular Formula | C15H13ClN2O |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 2-[4-(5-chloro-1,3-benzoxazol-2-yl)phenyl]ethanamine |
| SMILES | NCCc1ccc(-c2nc3cc(Cl)ccc3o2)cc1 |
| InChI | InChI=1S/C15H13ClN2O/c16-12-5-6-14-13(9-12)18-15(19-14)11-3-1-10(2-4-11)7-8-17/h1-6,9H,7-8,17H2 |
| InChIKey | KXRSJDNLEMOOHL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |