C16H14ClNO3 — CID 66706315
2-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]acetic acid;methane (PubChem CID 66706315) has the molecular formula C16H14ClNO3 and a molecular weight of 303.75 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]acetic acid;methane.
| Compound Name | 2-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]acetic acid;methane |
|---|---|
| PubChem CID | 66706315 |
| Molecular Formula | C16H14ClNO3 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]acetic acid;methane |
| SMILES | C.O=C(O)Cc1ccc2oc(-c3ccc(Cl)cc3)nc2c1 |
| InChI | InChI=1S/C15H10ClNO3.CH4/c16-11-4-2-10(3-5-11)15-17-12-7-9(8-14(18)19)1-6-13(12)20-15;/h1-7H,8H2,(H,18,19);1H4 |
| InChIKey | CDDNKDQPZDVGEG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |