C16H15ClN2O3 — CID 21149529
azanium 3-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]propanoate (PubChem CID 21149529) has the molecular formula C16H15ClN2O3 and a molecular weight of 318.76 g/mol. Its IUPAC name is azanium 3-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]propanoate.
| Compound Name | azanium 3-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]propanoate |
|---|---|
| PubChem CID | 21149529 |
| Molecular Formula | C16H15ClN2O3 |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | azanium 3-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]propanoate |
| SMILES | O=C([O-])CCc1ccc2oc(-c3ccc(Cl)cc3)nc2c1.[NH4+] |
| InChI | InChI=1S/C16H12ClNO3.H3N/c17-12-5-3-11(4-6-12)16-18-13-9-10(2-8-15(19)20)1-7-14(13)21-16;/h1,3-7,9H,2,8H2,(H,19,20);1H3 |
| InChIKey | ZHGKCKWUNIMCGT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |