C14H9Cl2NO2 — CID 82357851
[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]methanol (PubChem CID 82357851) has the molecular formula C14H9Cl2NO2 and a molecular weight of 294.14 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]methanol.
| Compound Name | [2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]methanol |
|---|---|
| PubChem CID | 82357851 |
| Molecular Formula | C14H9Cl2NO2 |
| Molecular Weight | 294.14 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | [2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]methanol |
| SMILES | OCc1ccc2oc(-c3ccc(Cl)c(Cl)c3)nc2c1 |
| InChI | InChI=1S/C14H9Cl2NO2/c15-10-3-2-9(6-11(10)16)14-17-12-5-8(7-18)1-4-13(12)19-14/h1-6,18H,7H2 |
| InChIKey | KCIMTZRPDCVHTC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.14 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |