C15H8Cl2N4O — CID 50881757
2-(3,4-dichlorophenyl)-5-(1,2,4-triazol-4-yl)-1,3-benzoxazole (PubChem CID 50881757) has the molecular formula C15H8Cl2N4O and a molecular weight of 331.16 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-5-(1,2,4-triazol-4-yl)-1,3-benzoxazole.
| Compound Name | 2-(3,4-dichlorophenyl)-5-(1,2,4-triazol-4-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 50881757 |
| Molecular Formula | C15H8Cl2N4O |
| Molecular Weight | 331.16 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-5-(1,2,4-triazol-4-yl)-1,3-benzoxazole |
| SMILES | Clc1ccc(-c2nc3cc(-n4cnnc4)ccc3o2)cc1Cl |
| InChI | InChI=1S/C15H8Cl2N4O/c16-11-3-1-9(5-12(11)17)15-20-13-6-10(2-4-14(13)22-15)21-7-18-19-8-21/h1-8H |
| InChIKey | XLCURXOGRRYLPV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.16 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |