C17H9Cl2NO2 — CID 168527045
2-(3,4-dichlorophenyl)-5-(furan-2-yl)-1,3-benzoxazole (PubChem CID 168527045) has the molecular formula C17H9Cl2NO2 and a molecular weight of 330.17 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-5-(furan-2-yl)-1,3-benzoxazole.
| Compound Name | 2-(3,4-dichlorophenyl)-5-(furan-2-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 168527045 |
| Molecular Formula | C17H9Cl2NO2 |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-5-(furan-2-yl)-1,3-benzoxazole |
| SMILES | Clc1ccc(-c2nc3cc(-c4ccco4)ccc3o2)cc1Cl |
| InChI | InChI=1S/C17H9Cl2NO2/c18-12-5-3-11(8-13(12)19)17-20-14-9-10(4-6-16(14)22-17)15-2-1-7-21-15/h1-9H |
| InChIKey | LHMJGFYZMNCTSB-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 39.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |