C19H11Cl2NO — CID 91678574
2-(3,5-dichlorophenyl)-5-phenyl-1,3-benzoxazole (PubChem CID 91678574) has the molecular formula C19H11Cl2NO and a molecular weight of 340.21 g/mol. Its IUPAC name is 2-(3,5-dichlorophenyl)-5-phenyl-1,3-benzoxazole.
| Compound Name | 2-(3,5-dichlorophenyl)-5-phenyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 91678574 |
| Molecular Formula | C19H11Cl2NO |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | 2-(3,5-dichlorophenyl)-5-phenyl-1,3-benzoxazole |
| SMILES | Clc1cc(Cl)cc(-c2nc3cc(-c4ccccc4)ccc3o2)c1 |
| InChI | InChI=1S/C19H11Cl2NO/c20-15-8-14(9-16(21)11-15)19-22-17-10-13(6-7-18(17)23-19)12-4-2-1-3-5-12/h1-11H |
| InChIKey | XWKHAXRAAOKHDU-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |