C19H13ClN2O — CID 67334689
4-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]aniline (PubChem CID 67334689) has the molecular formula C19H13ClN2O and a molecular weight of 320.78 g/mol. Its IUPAC name is 4-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]aniline.
| Compound Name | 4-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]aniline |
|---|---|
| PubChem CID | 67334689 |
| Molecular Formula | C19H13ClN2O |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 4-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]aniline |
| SMILES | Nc1ccc(-c2ccc3oc(-c4ccc(Cl)cc4)nc3c2)cc1 |
| InChI | InChI=1S/C19H13ClN2O/c20-15-6-1-13(2-7-15)19-22-17-11-14(5-10-18(17)23-19)12-3-8-16(21)9-4-12/h1-11H,21H2 |
| InChIKey | OQHIKXHUUZOJRC-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|