C13H9N3O3 — CID 14901574
2-(4-nitrophenyl)-1,3-benzoxazol-5-amine (PubChem CID 14901574) has the molecular formula C13H9N3O3 and a molecular weight of 255.23 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-1,3-benzoxazol-5-amine.
| Compound Name | 2-(4-nitrophenyl)-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 14901574 |
| Molecular Formula | C13H9N3O3 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 2-(4-nitrophenyl)-1,3-benzoxazol-5-amine |
| SMILES | Nc1ccc2oc(-c3ccc([N+](=O)[O-])cc3)nc2c1 |
| InChI | InChI=1S/C13H9N3O3/c14-9-3-6-12-11(7-9)15-13(19-12)8-1-4-10(5-2-8)16(17)18/h1-7H,14H2 |
| InChIKey | LUJRBKXLINGHSP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 95.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|