C23H28N2O4 — CID 102132367
2-(4-decoxyphenyl)-5-nitro-1,3-benzoxazole (PubChem CID 102132367) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is 2-(4-decoxyphenyl)-5-nitro-1,3-benzoxazole.
| Compound Name | 2-(4-decoxyphenyl)-5-nitro-1,3-benzoxazole |
|---|---|
| PubChem CID | 102132367 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 2-(4-decoxyphenyl)-5-nitro-1,3-benzoxazole |
| SMILES | CCCCCCCCCCOc1ccc(-c2nc3cc([N+](=O)[O-])ccc3o2)cc1 |
| InChI | InChI=1S/C23H28N2O4/c1-2-3-4-5-6-7-8-9-16-28-20-13-10-18(11-14-20)23-24-21-17-19(25(26)27)12-15-22(21)29-23/h10-15,17H,2-9,16H2,1H3 |
| InChIKey | ZWIACWJKQNMEEQ-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 78.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|